About (2E)-1-[(3,4-dichlorophenyl)methyl]-2-(nitromethylidene)imidazolidine
(2E)-1-[(3,4-dichlorophenyl)methyl]-2-(nitromethylidene)imidazolidine (PubChem CID 67844427) has the molecular formula C11H11Cl2N3O2
and a molecular weight of 288.13 g/mol. Its IUPAC name is (2E)-1-[(3,4-dichlorophenyl)methyl]-2-(nitromethylidene)imidazolidine.
Molecular Properties
| Compound Name | (2E)-1-[(3,4-dichlorophenyl)methyl]-2-(nitromethylidene)imidazolidine |
| PubChem CID | 67844427 |
| Molecular Formula | C11H11Cl2N3O2 |
| Molecular Weight | 288.13 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | (2E)-1-[(3,4-dichlorophenyl)methyl]-2-(nitromethylidene)imidazolidine |
| SMILES | O=[N+]([O-])/C=C1\NCCN1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H11Cl2N3O2/c12-9-2-1-8(5-10(9)13)6-15-4-3-14-11(15)7-16(17)18/h1-2,5,7,14H,3-4,6H2/b11-7+ |
| InChIKey | STEBXRGVPXQEAO-YRNVUSSQSA-N |
| XLogP | 2.47 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.13 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2E)-1-[(3,4-dichlorophenyl)methyl]-2-(nitromethylidene)imidazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-1-[(3,4-dichlorophenyl)methyl]-2-(nitromethylidene)imidazolidine?
The IUPAC name of (2E)-1-[(3,4-dichlorophenyl)methyl]-2-(nitromethylidene)imidazolidine (CID 67844427) is (2E)-1-[(3,4-dichlorophenyl)methyl]-2-(nitromethylidene)imidazolidine.
What is the SMILES notation for (2E)-1-[(3,4-dichlorophenyl)methyl]-2-(nitromethylidene)imidazolidine?
The canonical SMILES for (2E)-1-[(3,4-dichlorophenyl)methyl]-2-(nitromethylidene)imidazolidine is O=[N+]([O-])/C=C1\NCCN1Cc1ccc(Cl)c(Cl)c1.
What is the InChIKey of (2E)-1-[(3,4-dichlorophenyl)methyl]-2-(nitromethylidene)imidazolidine?
The InChIKey is STEBXRGVPXQEAO-YRNVUSSQSA-N. The full InChI is InChI=1S/C11H11Cl2N3O2/c12-9-2-1-8(5-10(9)13)6-15-4-3-14-11(15)7-16(17)18/h1-2,5,7,14H,3-4,6H2/b11-7+.
What are the key properties of (2E)-1-[(3,4-dichlorophenyl)methyl]-2-(nitromethylidene)imidazolidine?
(2E)-1-[(3,4-dichlorophenyl)methyl]-2-(nitromethylidene)imidazolidine has a molecular weight of 288.13 g/mol, XLogP of 2.47, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-1-[(3,4-dichlorophenyl)methyl]-2-(nitromethylidene)imidazolidine is sourced from PubChem (CID 67844427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).