About methyl 3-[3-methoxy-4-[(4-piperidin-4-ylbenzoyl)amino]phenyl]propanoate;hydrochloride
methyl 3-[3-methoxy-4-[(4-piperidin-4-ylbenzoyl)amino]phenyl]propanoate;hydrochloride (PubChem CID 67844603) has the molecular formula C23H29ClN2O4
and a molecular weight of 432.95 g/mol. Its IUPAC name is methyl 3-[3-methoxy-4-[(4-piperidin-4-ylbenzoyl)amino]phenyl]propanoate;hydrochloride.
Molecular Properties
| Compound Name | methyl 3-[3-methoxy-4-[(4-piperidin-4-ylbenzoyl)amino]phenyl]propanoate;hydrochloride |
| PubChem CID | 67844603 |
| Molecular Formula | C23H29ClN2O4 |
| Molecular Weight | 432.95 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | methyl 3-[3-methoxy-4-[(4-piperidin-4-ylbenzoyl)amino]phenyl]propanoate;hydrochloride |
| SMILES | COC(=O)CCc1ccc(NC(=O)c2ccc(C3CCNCC3)cc2)c(OC)c1.Cl |
| InChI | InChI=1S/C23H28N2O4.ClH/c1-28-21-15-16(4-10-22(26)29-2)3-9-20(21)25-23(27)19-7-5-17(6-8-19)18-11-13-24-14-12-18;/h3,5-9,15,18,24H,4,10-14H2,1-2H3,(H,25,27);1H |
| InChIKey | CRDFBEXHCZQISO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.95 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-[3-methoxy-4-[(4-piperidin-4-ylbenzoyl)amino]phenyl]propanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[3-methoxy-4-[(4-piperidin-4-ylbenzoyl)amino]phenyl]propanoate;hydrochloride?
The IUPAC name of methyl 3-[3-methoxy-4-[(4-piperidin-4-ylbenzoyl)amino]phenyl]propanoate;hydrochloride (CID 67844603) is methyl 3-[3-methoxy-4-[(4-piperidin-4-ylbenzoyl)amino]phenyl]propanoate;hydrochloride.
What is the SMILES notation for methyl 3-[3-methoxy-4-[(4-piperidin-4-ylbenzoyl)amino]phenyl]propanoate;hydrochloride?
The canonical SMILES for methyl 3-[3-methoxy-4-[(4-piperidin-4-ylbenzoyl)amino]phenyl]propanoate;hydrochloride is COC(=O)CCc1ccc(NC(=O)c2ccc(C3CCNCC3)cc2)c(OC)c1.Cl.
What is the InChIKey of methyl 3-[3-methoxy-4-[(4-piperidin-4-ylbenzoyl)amino]phenyl]propanoate;hydrochloride?
The InChIKey is CRDFBEXHCZQISO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28N2O4.ClH/c1-28-21-15-16(4-10-22(26)29-2)3-9-20(21)25-23(27)19-7-5-17(6-8-19)18-11-13-24-14-12-18;/h3,5-9,15,18,24H,4,10-14H2,1-2H3,(H,25,27);1H.
What are the key properties of methyl 3-[3-methoxy-4-[(4-piperidin-4-ylbenzoyl)amino]phenyl]propanoate;hydrochloride?
methyl 3-[3-methoxy-4-[(4-piperidin-4-ylbenzoyl)amino]phenyl]propanoate;hydrochloride has a molecular weight of 432.95 g/mol, XLogP of 3.94, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[3-methoxy-4-[(4-piperidin-4-ylbenzoyl)amino]phenyl]propanoate;hydrochloride is sourced from PubChem (CID 67844603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).