C12H16O10 — CID 67845146
[5-[[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]furan-2-yl] hydrogen carbonate (PubChem CID 67845146) has the molecular formula C12H16O10 and a molecular weight of 320.25 g/mol. Its IUPAC name is [5-[[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]furan-2-yl] hydrogen carbonate.
| Compound Name | [5-[[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]furan-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 67845146 |
| Molecular Formula | C12H16O10 |
| Molecular Weight | 320.25 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | [5-[[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]furan-2-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1ccc(COC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)o1 |
| InChI | InChI=1S/C12H16O10/c13-3-6-8(14)9(15)10(16)11(21-6)19-4-5-1-2-7(20-5)22-12(17)18/h1-2,6,8-11,13-16H,3-4H2,(H,17,18)/t6-,8-,9+,10-,11?/m1/s1 |
| InChIKey | GQCVSPYZAXJIDX-YKVPTUPCSA-N |
| XLogP | -1.35 |
| TPSA | 159.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.25 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |