C20H29N3O3 — CID 67845328
tert-butyl N-[(2S)-2-[1-(1H-indol-3-yl)ethylamino]-3-methylbutanoyl]carbamate (PubChem CID 67845328) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is tert-butyl N-[(2S)-2-[1-(1H-indol-3-yl)ethylamino]-3-methylbutanoyl]carbamate.
| Compound Name | tert-butyl N-[(2S)-2-[1-(1H-indol-3-yl)ethylamino]-3-methylbutanoyl]carbamate |
|---|---|
| PubChem CID | 67845328 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | tert-butyl N-[(2S)-2-[1-(1H-indol-3-yl)ethylamino]-3-methylbutanoyl]carbamate |
| SMILES | CC(N[C@H](C(=O)NC(=O)OC(C)(C)C)C(C)C)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H29N3O3/c1-12(2)17(18(24)23-19(25)26-20(4,5)6)22-13(3)15-11-21-16-10-8-7-9-14(15)16/h7-13,17,21-22H,1-6H3,(H,23,24,25)/t13?,17-/m0/s1 |
| InChIKey | UYWANQRMSANMMB-RUINGEJQSA-N |
| XLogP | 3.89 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |