About but-2-enedioic acid;5-chloro-3-[[1-(cyclohexylmethyl)piperidin-4-yl]methoxy]-1,2-benzoxazole
but-2-enedioic acid;5-chloro-3-[[1-(cyclohexylmethyl)piperidin-4-yl]methoxy]-1,2-benzoxazole (PubChem CID 67845359) has the molecular formula C24H31ClN2O6
and a molecular weight of 478.97 g/mol. Its IUPAC name is but-2-enedioic acid;5-chloro-3-[[1-(cyclohexylmethyl)piperidin-4-yl]methoxy]-1,2-benzoxazole.
Molecular Properties
| Compound Name | but-2-enedioic acid;5-chloro-3-[[1-(cyclohexylmethyl)piperidin-4-yl]methoxy]-1,2-benzoxazole |
| PubChem CID | 67845359 |
| Molecular Formula | C24H31ClN2O6 |
| Molecular Weight | 478.97 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | but-2-enedioic acid;5-chloro-3-[[1-(cyclohexylmethyl)piperidin-4-yl]methoxy]-1,2-benzoxazole |
| SMILES | Clc1ccc2onc(OCC3CCN(CC4CCCCC4)CC3)c2c1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C20H27ClN2O2.C4H4O4/c21-17-6-7-19-18(12-17)20(22-25-19)24-14-16-8-10-23(11-9-16)13-15-4-2-1-3-5-15;5-3(6)1-2-4(7)8/h6-7,12,15-16H,1-5,8-11,13-14H2;1-2H,(H,5,6)(H,7,8) |
| InChIKey | XGPVITWVFQTBIC-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 478.97 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze but-2-enedioic acid;5-chloro-3-[[1-(cyclohexylmethyl)piperidin-4-yl]methoxy]-1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-enedioic acid;5-chloro-3-[[1-(cyclohexylmethyl)piperidin-4-yl]methoxy]-1,2-benzoxazole?
The IUPAC name of but-2-enedioic acid;5-chloro-3-[[1-(cyclohexylmethyl)piperidin-4-yl]methoxy]-1,2-benzoxazole (CID 67845359) is but-2-enedioic acid;5-chloro-3-[[1-(cyclohexylmethyl)piperidin-4-yl]methoxy]-1,2-benzoxazole.
What is the SMILES notation for but-2-enedioic acid;5-chloro-3-[[1-(cyclohexylmethyl)piperidin-4-yl]methoxy]-1,2-benzoxazole?
The canonical SMILES for but-2-enedioic acid;5-chloro-3-[[1-(cyclohexylmethyl)piperidin-4-yl]methoxy]-1,2-benzoxazole is Clc1ccc2onc(OCC3CCN(CC4CCCCC4)CC3)c2c1.O=C(O)C=CC(=O)O.
What is the InChIKey of but-2-enedioic acid;5-chloro-3-[[1-(cyclohexylmethyl)piperidin-4-yl]methoxy]-1,2-benzoxazole?
The InChIKey is XGPVITWVFQTBIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27ClN2O2.C4H4O4/c21-17-6-7-19-18(12-17)20(22-25-19)24-14-16-8-10-23(11-9-16)13-15-4-2-1-3-5-15;5-3(6)1-2-4(7)8/h6-7,12,15-16H,1-5,8-11,13-14H2;1-2H,(H,5,6)(H,7,8).
What are the key properties of but-2-enedioic acid;5-chloro-3-[[1-(cyclohexylmethyl)piperidin-4-yl]methoxy]-1,2-benzoxazole?
but-2-enedioic acid;5-chloro-3-[[1-(cyclohexylmethyl)piperidin-4-yl]methoxy]-1,2-benzoxazole has a molecular weight of 478.97 g/mol, XLogP of 4.86, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-enedioic acid;5-chloro-3-[[1-(cyclohexylmethyl)piperidin-4-yl]methoxy]-1,2-benzoxazole is sourced from PubChem (CID 67845359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).