About but-2-enedioic acid;5-methyl-2-[2-[1-(2-phenylethyl)piperidin-4-yl]ethyl]-1,2-benzoxazol-3-one
but-2-enedioic acid;5-methyl-2-[2-[1-(2-phenylethyl)piperidin-4-yl]ethyl]-1,2-benzoxazol-3-one (PubChem CID 67845387) has the molecular formula C27H32N2O6
and a molecular weight of 480.56 g/mol. Its IUPAC name is but-2-enedioic acid;5-methyl-2-[2-[1-(2-phenylethyl)piperidin-4-yl]ethyl]-1,2-benzoxazol-3-one.
Molecular Properties
| Compound Name | but-2-enedioic acid;5-methyl-2-[2-[1-(2-phenylethyl)piperidin-4-yl]ethyl]-1,2-benzoxazol-3-one |
| PubChem CID | 67845387 |
| Molecular Formula | C27H32N2O6 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | but-2-enedioic acid;5-methyl-2-[2-[1-(2-phenylethyl)piperidin-4-yl]ethyl]-1,2-benzoxazol-3-one |
| SMILES | Cc1ccc2on(CCC3CCN(CCc4ccccc4)CC3)c(=O)c2c1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C23H28N2O2.C4H4O4/c1-18-7-8-22-21(17-18)23(26)25(27-22)16-12-20-10-14-24(15-11-20)13-9-19-5-3-2-4-6-19;5-3(6)1-2-4(7)8/h2-8,17,20H,9-16H2,1H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | JMOGGAOLHWFKJS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 112.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze but-2-enedioic acid;5-methyl-2-[2-[1-(2-phenylethyl)piperidin-4-yl]ethyl]-1,2-benzoxazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-enedioic acid;5-methyl-2-[2-[1-(2-phenylethyl)piperidin-4-yl]ethyl]-1,2-benzoxazol-3-one?
The IUPAC name of but-2-enedioic acid;5-methyl-2-[2-[1-(2-phenylethyl)piperidin-4-yl]ethyl]-1,2-benzoxazol-3-one (CID 67845387) is but-2-enedioic acid;5-methyl-2-[2-[1-(2-phenylethyl)piperidin-4-yl]ethyl]-1,2-benzoxazol-3-one.
What is the SMILES notation for but-2-enedioic acid;5-methyl-2-[2-[1-(2-phenylethyl)piperidin-4-yl]ethyl]-1,2-benzoxazol-3-one?
The canonical SMILES for but-2-enedioic acid;5-methyl-2-[2-[1-(2-phenylethyl)piperidin-4-yl]ethyl]-1,2-benzoxazol-3-one is Cc1ccc2on(CCC3CCN(CCc4ccccc4)CC3)c(=O)c2c1.O=C(O)C=CC(=O)O.
What is the InChIKey of but-2-enedioic acid;5-methyl-2-[2-[1-(2-phenylethyl)piperidin-4-yl]ethyl]-1,2-benzoxazol-3-one?
The InChIKey is JMOGGAOLHWFKJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28N2O2.C4H4O4/c1-18-7-8-22-21(17-18)23(26)25(27-22)16-12-20-10-14-24(15-11-20)13-9-19-5-3-2-4-6-19;5-3(6)1-2-4(7)8/h2-8,17,20H,9-16H2,1H3;1-2H,(H,5,6)(H,7,8).
What are the key properties of but-2-enedioic acid;5-methyl-2-[2-[1-(2-phenylethyl)piperidin-4-yl]ethyl]-1,2-benzoxazol-3-one?
but-2-enedioic acid;5-methyl-2-[2-[1-(2-phenylethyl)piperidin-4-yl]ethyl]-1,2-benzoxazol-3-one has a molecular weight of 480.56 g/mol, XLogP of 3.96, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-enedioic acid;5-methyl-2-[2-[1-(2-phenylethyl)piperidin-4-yl]ethyl]-1,2-benzoxazol-3-one is sourced from PubChem (CID 67845387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).