About 2,3-dihydrofuro[2,3-g]indol-1-ylmethanol
2,3-dihydrofuro[2,3-g]indol-1-ylmethanol (PubChem CID 67845535) has the molecular formula C11H11NO2
and a molecular weight of 189.21 g/mol. Its IUPAC name is 2,3-dihydrofuro[2,3-g]indol-1-ylmethanol.
Molecular Properties
| Compound Name | 2,3-dihydrofuro[2,3-g]indol-1-ylmethanol |
| PubChem CID | 67845535 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 2,3-dihydrofuro[2,3-g]indol-1-ylmethanol |
| SMILES | OCN1CCc2ccc3occc3c21 |
| InChI | InChI=1S/C11H11NO2/c13-7-12-5-3-8-1-2-10-9(11(8)12)4-6-14-10/h1-2,4,6,13H,3,5,7H2 |
| InChIKey | JIYFFJPHIVROSI-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dihydrofuro[2,3-g]indol-1-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydrofuro[2,3-g]indol-1-ylmethanol?
The IUPAC name of 2,3-dihydrofuro[2,3-g]indol-1-ylmethanol (CID 67845535) is 2,3-dihydrofuro[2,3-g]indol-1-ylmethanol.
What is the SMILES notation for 2,3-dihydrofuro[2,3-g]indol-1-ylmethanol?
The canonical SMILES for 2,3-dihydrofuro[2,3-g]indol-1-ylmethanol is OCN1CCc2ccc3occc3c21.
What is the InChIKey of 2,3-dihydrofuro[2,3-g]indol-1-ylmethanol?
The InChIKey is JIYFFJPHIVROSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO2/c13-7-12-5-3-8-1-2-10-9(11(8)12)4-6-14-10/h1-2,4,6,13H,3,5,7H2.
What are the key properties of 2,3-dihydrofuro[2,3-g]indol-1-ylmethanol?
2,3-dihydrofuro[2,3-g]indol-1-ylmethanol has a molecular weight of 189.21 g/mol, XLogP of 1.75, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydrofuro[2,3-g]indol-1-ylmethanol is sourced from PubChem (CID 67845535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).