About 3-[1-methyl-2-(4-piperidin-4-ylphenyl)benzimidazol-5-yl]prop-2-enoic acid;dihydrobromide
3-[1-methyl-2-(4-piperidin-4-ylphenyl)benzimidazol-5-yl]prop-2-enoic acid;dihydrobromide (PubChem CID 67845728) has the molecular formula C22H25Br2N3O2
and a molecular weight of 523.27 g/mol. Its IUPAC name is 3-[1-methyl-2-(4-piperidin-4-ylphenyl)benzimidazol-5-yl]prop-2-enoic acid;dihydrobromide.
Molecular Properties
| Compound Name | 3-[1-methyl-2-(4-piperidin-4-ylphenyl)benzimidazol-5-yl]prop-2-enoic acid;dihydrobromide |
| PubChem CID | 67845728 |
| Molecular Formula | C22H25Br2N3O2 |
| Molecular Weight | 523.27 g/mol |
| Exact Mass | 521.03 |
| IUPAC Name | 3-[1-methyl-2-(4-piperidin-4-ylphenyl)benzimidazol-5-yl]prop-2-enoic acid;dihydrobromide |
| SMILES | Br.Br.Cn1c(-c2ccc(C3CCNCC3)cc2)nc2cc(C=CC(=O)O)ccc21 |
| InChI | InChI=1S/C22H23N3O2.2BrH/c1-25-20-8-2-15(3-9-21(26)27)14-19(20)24-22(25)18-6-4-16(5-7-18)17-10-12-23-13-11-17;;/h2-9,14,17,23H,10-13H2,1H3,(H,26,27);2*1H |
| InChIKey | KVCYPAGRMMMGNM-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 523.27 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[1-methyl-2-(4-piperidin-4-ylphenyl)benzimidazol-5-yl]prop-2-enoic acid;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-methyl-2-(4-piperidin-4-ylphenyl)benzimidazol-5-yl]prop-2-enoic acid;dihydrobromide?
The IUPAC name of 3-[1-methyl-2-(4-piperidin-4-ylphenyl)benzimidazol-5-yl]prop-2-enoic acid;dihydrobromide (CID 67845728) is 3-[1-methyl-2-(4-piperidin-4-ylphenyl)benzimidazol-5-yl]prop-2-enoic acid;dihydrobromide.
What is the SMILES notation for 3-[1-methyl-2-(4-piperidin-4-ylphenyl)benzimidazol-5-yl]prop-2-enoic acid;dihydrobromide?
The canonical SMILES for 3-[1-methyl-2-(4-piperidin-4-ylphenyl)benzimidazol-5-yl]prop-2-enoic acid;dihydrobromide is Br.Br.Cn1c(-c2ccc(C3CCNCC3)cc2)nc2cc(C=CC(=O)O)ccc21.
What is the InChIKey of 3-[1-methyl-2-(4-piperidin-4-ylphenyl)benzimidazol-5-yl]prop-2-enoic acid;dihydrobromide?
The InChIKey is KVCYPAGRMMMGNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N3O2.2BrH/c1-25-20-8-2-15(3-9-21(26)27)14-19(20)24-22(25)18-6-4-16(5-7-18)17-10-12-23-13-11-17;;/h2-9,14,17,23H,10-13H2,1H3,(H,26,27);2*1H.
What are the key properties of 3-[1-methyl-2-(4-piperidin-4-ylphenyl)benzimidazol-5-yl]prop-2-enoic acid;dihydrobromide?
3-[1-methyl-2-(4-piperidin-4-ylphenyl)benzimidazol-5-yl]prop-2-enoic acid;dihydrobromide has a molecular weight of 523.27 g/mol, XLogP of 4.96, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-methyl-2-(4-piperidin-4-ylphenyl)benzimidazol-5-yl]prop-2-enoic acid;dihydrobromide is sourced from PubChem (CID 67845728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).