C26H30N4O3 — CID 67845997
N-[9-[(2-methoxyphenyl)methyl]-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl]-1-prop-2-enylindazole-3-carboxamide (PubChem CID 67845997) has the molecular formula C26H30N4O3 and a molecular weight of 446.55 g/mol. Its IUPAC name is N-[9-[(2-methoxyphenyl)methyl]-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl]-1-prop-2-enylindazole-3-carboxamide.
| Compound Name | N-[9-[(2-methoxyphenyl)methyl]-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl]-1-prop-2-enylindazole-3-carboxamide |
|---|---|
| PubChem CID | 67845997 |
| Molecular Formula | C26H30N4O3 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | N-[9-[(2-methoxyphenyl)methyl]-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl]-1-prop-2-enylindazole-3-carboxamide |
| SMILES | C=CCn1nc(C(=O)NC2CC3COCC(C2)N3Cc2ccccc2OC)c2ccccc21 |
| InChI | InChI=1S/C26H30N4O3/c1-3-12-30-23-10-6-5-9-22(23)25(28-30)26(31)27-19-13-20-16-33-17-21(14-19)29(20)15-18-8-4-7-11-24(18)32-2/h3-11,19-21H,1,12-17H2,2H3,(H,27,31) |
| InChIKey | QZXPXFVWZKMVFD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|