About 2,5-diphenyl-1H-imidazole;5-methyl-2,4-diphenyl-1H-imidazole
2,5-diphenyl-1H-imidazole;5-methyl-2,4-diphenyl-1H-imidazole (PubChem CID 67847310) has the molecular formula C31H26N4
and a molecular weight of 454.58 g/mol. Its IUPAC name is 2,5-diphenyl-1H-imidazole;5-methyl-2,4-diphenyl-1H-imidazole.
Molecular Properties
| Compound Name | 2,5-diphenyl-1H-imidazole;5-methyl-2,4-diphenyl-1H-imidazole |
| PubChem CID | 67847310 |
| Molecular Formula | C31H26N4 |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | 2,5-diphenyl-1H-imidazole;5-methyl-2,4-diphenyl-1H-imidazole |
| SMILES | Cc1[nH]c(-c2ccccc2)nc1-c1ccccc1.c1ccc(-c2cnc(-c3ccccc3)[nH]2)cc1 |
| InChI | InChI=1S/C16H14N2.C15H12N2/c1-12-15(13-8-4-2-5-9-13)18-16(17-12)14-10-6-3-7-11-14;1-3-7-12(8-4-1)14-11-16-15(17-14)13-9-5-2-6-10-13/h2-11H,1H3,(H,17,18);1-11H,(H,16,17) |
| InChIKey | NHTRZIVRYXPDJY-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-diphenyl-1H-imidazole;5-methyl-2,4-diphenyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-diphenyl-1H-imidazole;5-methyl-2,4-diphenyl-1H-imidazole?
The IUPAC name of 2,5-diphenyl-1H-imidazole;5-methyl-2,4-diphenyl-1H-imidazole (CID 67847310) is 2,5-diphenyl-1H-imidazole;5-methyl-2,4-diphenyl-1H-imidazole.
What is the SMILES notation for 2,5-diphenyl-1H-imidazole;5-methyl-2,4-diphenyl-1H-imidazole?
The canonical SMILES for 2,5-diphenyl-1H-imidazole;5-methyl-2,4-diphenyl-1H-imidazole is Cc1[nH]c(-c2ccccc2)nc1-c1ccccc1.c1ccc(-c2cnc(-c3ccccc3)[nH]2)cc1.
What is the InChIKey of 2,5-diphenyl-1H-imidazole;5-methyl-2,4-diphenyl-1H-imidazole?
The InChIKey is NHTRZIVRYXPDJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2.C15H12N2/c1-12-15(13-8-4-2-5-9-13)18-16(17-12)14-10-6-3-7-11-14;1-3-7-12(8-4-1)14-11-16-15(17-14)13-9-5-2-6-10-13/h2-11H,1H3,(H,17,18);1-11H,(H,16,17).
What are the key properties of 2,5-diphenyl-1H-imidazole;5-methyl-2,4-diphenyl-1H-imidazole?
2,5-diphenyl-1H-imidazole;5-methyl-2,4-diphenyl-1H-imidazole has a molecular weight of 454.58 g/mol, XLogP of 7.80, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-diphenyl-1H-imidazole;5-methyl-2,4-diphenyl-1H-imidazole is sourced from PubChem (CID 67847310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).