C28H38N4O14 — CID 67847720
[(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-[[4-[(dimethylamino)methyl]morpholine-3-carbonyl]amino]-2-nitrophenoxy]oxan-2-yl]methyl acetate (PubChem CID 67847720) has the molecular formula C28H38N4O14 and a molecular weight of 654.63 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-[[4-[(dimethylamino)methyl]morpholine-3-carbonyl]amino]-2-nitrophenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-[[4-[(dimethylamino)methyl]morpholine-3-carbonyl]amino]-2-nitrophenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 67847720 |
| Molecular Formula | C28H38N4O14 |
| Molecular Weight | 654.63 g/mol |
| Exact Mass | 654.24 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-[[4-[(dimethylamino)methyl]morpholine-3-carbonyl]amino]-2-nitrophenoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2ccc(NC(=O)C3COCCN3CN(C)C)cc2[N+](=O)[O-])[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C28H38N4O14/c1-15(33)41-13-23-24(42-16(2)34)25(43-17(3)35)26(44-18(4)36)28(46-23)45-22-8-7-19(11-20(22)32(38)39)29-27(37)21-12-40-10-9-31(21)14-30(5)6/h7-8,11,21,23-26,28H,9-10,12-14H2,1-6H3,(H,29,37)/t21?,23-,24+,25+,26-,28-/m1/s1 |
| InChIKey | VBYVAWVYOLQOHP-NABVVELJSA-N |
| XLogP | 0.22 |
| TPSA | 211.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.63 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|