C15H19F2NO — CID 67847861
2-(2,6-difluorophenyl)-4-hexyl-4,5-dihydro-1,3-oxazole (PubChem CID 67847861) has the molecular formula C15H19F2NO and a molecular weight of 267.32 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-4-hexyl-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-(2,6-difluorophenyl)-4-hexyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 67847861 |
| Molecular Formula | C15H19F2NO |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 2-(2,6-difluorophenyl)-4-hexyl-4,5-dihydro-1,3-oxazole |
| SMILES | CCCCCCC1COC(c2c(F)cccc2F)=N1 |
| InChI | InChI=1S/C15H19F2NO/c1-2-3-4-5-7-11-10-19-15(18-11)14-12(16)8-6-9-13(14)17/h6,8-9,11H,2-5,7,10H2,1H3 |
| InChIKey | TUSPVLLWICDJRP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|