About bromobenzene;hepta-1,6-dien-4-one
bromobenzene;hepta-1,6-dien-4-one (PubChem CID 67847956) has the molecular formula C13H15BrO
and a molecular weight of 267.17 g/mol. Its IUPAC name is bromobenzene;hepta-1,6-dien-4-one.
Molecular Properties
| Compound Name | bromobenzene;hepta-1,6-dien-4-one |
| PubChem CID | 67847956 |
| Molecular Formula | C13H15BrO |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | bromobenzene;hepta-1,6-dien-4-one |
| SMILES | Brc1ccccc1.C=CCC(=O)CC=C |
| InChI | InChI=1S/C7H10O.C6H5Br/c1-3-5-7(8)6-4-2;7-6-4-2-1-3-5-6/h3-4H,1-2,5-6H2;1-5H |
| InChIKey | FADQPSZAPFPWED-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bromobenzene;hepta-1,6-dien-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromobenzene;hepta-1,6-dien-4-one?
The IUPAC name of bromobenzene;hepta-1,6-dien-4-one (CID 67847956) is bromobenzene;hepta-1,6-dien-4-one.
What is the SMILES notation for bromobenzene;hepta-1,6-dien-4-one?
The canonical SMILES for bromobenzene;hepta-1,6-dien-4-one is Brc1ccccc1.C=CCC(=O)CC=C.
What is the InChIKey of bromobenzene;hepta-1,6-dien-4-one?
The InChIKey is FADQPSZAPFPWED-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O.C6H5Br/c1-3-5-7(8)6-4-2;7-6-4-2-1-3-5-6/h3-4H,1-2,5-6H2;1-5H.
What are the key properties of bromobenzene;hepta-1,6-dien-4-one?
bromobenzene;hepta-1,6-dien-4-one has a molecular weight of 267.17 g/mol, XLogP of 4.16, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bromobenzene;hepta-1,6-dien-4-one is sourced from PubChem (CID 67847956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).