C12H16O4 — CID 67848026
4-butylcyclohexa-1,5-diene-1,4-dicarboxylic acid (PubChem CID 67848026) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is 4-butylcyclohexa-1,5-diene-1,4-dicarboxylic acid.
| Compound Name | 4-butylcyclohexa-1,5-diene-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 67848026 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 4-butylcyclohexa-1,5-diene-1,4-dicarboxylic acid |
| SMILES | CCCCC1(C(=O)O)C=CC(C(=O)O)=CC1 |
| InChI | InChI=1S/C12H16O4/c1-2-3-6-12(11(15)16)7-4-9(5-8-12)10(13)14/h4-5,7H,2-3,6,8H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | VYQGMKDEBUDIKY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |