C19H38N4O2 — CID 67848255
6-[amino-(1-butyl-2,2,6,6-tetramethylpiperidin-4-yl)amino]-6-oxohexanamide (PubChem CID 67848255) has the molecular formula C19H38N4O2 and a molecular weight of 354.54 g/mol. Its IUPAC name is 6-[amino-(1-butyl-2,2,6,6-tetramethylpiperidin-4-yl)amino]-6-oxohexanamide.
| Compound Name | 6-[amino-(1-butyl-2,2,6,6-tetramethylpiperidin-4-yl)amino]-6-oxohexanamide |
|---|---|
| PubChem CID | 67848255 |
| Molecular Formula | C19H38N4O2 |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.30 |
| IUPAC Name | 6-[amino-(1-butyl-2,2,6,6-tetramethylpiperidin-4-yl)amino]-6-oxohexanamide |
| SMILES | CCCCN1C(C)(C)CC(N(N)C(=O)CCCCC(N)=O)CC1(C)C |
| InChI | InChI=1S/C19H38N4O2/c1-6-7-12-22-18(2,3)13-15(14-19(22,4)5)23(21)17(25)11-9-8-10-16(20)24/h15H,6-14,21H2,1-5H3,(H2,20,24) |
| InChIKey | LZGQGLKVLVPDSG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 92.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|