C26H18F4O4 — CID 67848839
2-fluoro-3-[2,2,2-tris(2-fluoro-3-hydroxyphenyl)ethyl]phenol (PubChem CID 67848839) has the molecular formula C26H18F4O4 and a molecular weight of 470.42 g/mol. Its IUPAC name is 2-fluoro-3-[2,2,2-tris(2-fluoro-3-hydroxyphenyl)ethyl]phenol.
| Compound Name | 2-fluoro-3-[2,2,2-tris(2-fluoro-3-hydroxyphenyl)ethyl]phenol |
|---|---|
| PubChem CID | 67848839 |
| Molecular Formula | C26H18F4O4 |
| Molecular Weight | 470.42 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | 2-fluoro-3-[2,2,2-tris(2-fluoro-3-hydroxyphenyl)ethyl]phenol |
| SMILES | Oc1cccc(CC(c2cccc(O)c2F)(c2cccc(O)c2F)c2cccc(O)c2F)c1F |
| InChI | InChI=1S/C26H18F4O4/c27-22-14(5-1-9-18(22)31)13-26(15-6-2-10-19(32)23(15)28,16-7-3-11-20(33)24(16)29)17-8-4-12-21(34)25(17)30/h1-12,31-34H,13H2 |
| InChIKey | VKRPBFGPQXSFMU-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.42 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|