About 2-cyclohexyl-1-(6,10-dimethylundecan-2-yl)guanidine
2-cyclohexyl-1-(6,10-dimethylundecan-2-yl)guanidine (PubChem CID 67849622) has the molecular formula C20H41N3
and a molecular weight of 323.57 g/mol. Its IUPAC name is 2-cyclohexyl-1-(6,10-dimethylundecan-2-yl)guanidine.
Molecular Properties
| Compound Name | 2-cyclohexyl-1-(6,10-dimethylundecan-2-yl)guanidine |
| PubChem CID | 67849622 |
| Molecular Formula | C20H41N3 |
| Molecular Weight | 323.57 g/mol |
| Exact Mass | 323.33 |
| IUPAC Name | 2-cyclohexyl-1-(6,10-dimethylundecan-2-yl)guanidine |
| SMILES | CC(C)CCCC(C)CCCC(C)N/C(N)=N/C1CCCCC1 |
| InChI | InChI=1S/C20H41N3/c1-16(2)10-8-11-17(3)12-9-13-18(4)22-20(21)23-19-14-6-5-7-15-19/h16-19H,5-15H2,1-4H3,(H3,21,22,23) |
| InChIKey | PQPPGGOSJNOSQI-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 323.57 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexyl-1-(6,10-dimethylundecan-2-yl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-1-(6,10-dimethylundecan-2-yl)guanidine?
The IUPAC name of 2-cyclohexyl-1-(6,10-dimethylundecan-2-yl)guanidine (CID 67849622) is 2-cyclohexyl-1-(6,10-dimethylundecan-2-yl)guanidine.
What is the SMILES notation for 2-cyclohexyl-1-(6,10-dimethylundecan-2-yl)guanidine?
The canonical SMILES for 2-cyclohexyl-1-(6,10-dimethylundecan-2-yl)guanidine is CC(C)CCCC(C)CCCC(C)N/C(N)=N/C1CCCCC1.
What is the InChIKey of 2-cyclohexyl-1-(6,10-dimethylundecan-2-yl)guanidine?
The InChIKey is PQPPGGOSJNOSQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H41N3/c1-16(2)10-8-11-17(3)12-9-13-18(4)22-20(21)23-19-14-6-5-7-15-19/h16-19H,5-15H2,1-4H3,(H3,21,22,23).
What are the key properties of 2-cyclohexyl-1-(6,10-dimethylundecan-2-yl)guanidine?
2-cyclohexyl-1-(6,10-dimethylundecan-2-yl)guanidine has a molecular weight of 323.57 g/mol, XLogP of 5.24, 10 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-1-(6,10-dimethylundecan-2-yl)guanidine is sourced from PubChem (CID 67849622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).