C17H22ClNO — CID 67849625
5-chloro-8-methoxy-N,N-bis(prop-2-enyl)-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 67849625) has the molecular formula C17H22ClNO and a molecular weight of 291.82 g/mol. Its IUPAC name is 5-chloro-8-methoxy-N,N-bis(prop-2-enyl)-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | 5-chloro-8-methoxy-N,N-bis(prop-2-enyl)-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 67849625 |
| Molecular Formula | C17H22ClNO |
| Molecular Weight | 291.82 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 5-chloro-8-methoxy-N,N-bis(prop-2-enyl)-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | C=CCN(CC=C)C1CCc2c(Cl)ccc(OC)c2C1 |
| InChI | InChI=1S/C17H22ClNO/c1-4-10-19(11-5-2)13-6-7-14-15(12-13)17(20-3)9-8-16(14)18/h4-5,8-9,13H,1-2,6-7,10-12H2,3H3 |
| InChIKey | XUCZOWSSSKBJOV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.82 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|