C22H19N3O3S2 — CID 67849853
4-[[4-[[(2R)-1-(1,3-benzothiazol-2-yl)pyrrolidin-2-yl]methoxy]phenyl]methylidene]-1,3-thiazolidine-2,5-dione (PubChem CID 67849853) has the molecular formula C22H19N3O3S2 and a molecular weight of 437.55 g/mol. Its IUPAC name is 4-[[4-[[(2R)-1-(1,3-benzothiazol-2-yl)pyrrolidin-2-yl]methoxy]phenyl]methylidene]-1,3-thiazolidine-2,5-dione.
| Compound Name | 4-[[4-[[(2R)-1-(1,3-benzothiazol-2-yl)pyrrolidin-2-yl]methoxy]phenyl]methylidene]-1,3-thiazolidine-2,5-dione |
|---|---|
| PubChem CID | 67849853 |
| Molecular Formula | C22H19N3O3S2 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | 4-[[4-[[(2R)-1-(1,3-benzothiazol-2-yl)pyrrolidin-2-yl]methoxy]phenyl]methylidene]-1,3-thiazolidine-2,5-dione |
| SMILES | O=C1NC(=Cc2ccc(OC[C@H]3CCCN3c3nc4ccccc4s3)cc2)C(=O)S1 |
| InChI | InChI=1S/C22H19N3O3S2/c26-20-18(24-22(27)30-20)12-14-7-9-16(10-8-14)28-13-15-4-3-11-25(15)21-23-17-5-1-2-6-19(17)29-21/h1-2,5-10,12,15H,3-4,11,13H2,(H,24,27)/t15-/m1/s1 |
| InChIKey | LKELNFKMIZSDTB-OAHLLOKOSA-N |
| XLogP | 4.67 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|