About 1,2-oxazole-3,4-dicarboxamide
1,2-oxazole-3,4-dicarboxamide (PubChem CID 67849858) has the molecular formula C5H5N3O3
and a molecular weight of 155.11 g/mol. Its IUPAC name is 1,2-oxazole-3,4-dicarboxamide.
Molecular Properties
| Compound Name | 1,2-oxazole-3,4-dicarboxamide |
| PubChem CID | 67849858 |
| Molecular Formula | C5H5N3O3 |
| Molecular Weight | 155.11 g/mol |
| Exact Mass | 155.03 |
| IUPAC Name | 1,2-oxazole-3,4-dicarboxamide |
| SMILES | NC(=O)c1conc1C(N)=O |
| InChI | InChI=1S/C5H5N3O3/c6-4(9)2-1-11-8-3(2)5(7)10/h1H,(H2,6,9)(H2,7,10) |
| InChIKey | CCCKDAJIRSOBGX-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 112.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.11 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,2-oxazole-3,4-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-oxazole-3,4-dicarboxamide?
The IUPAC name of 1,2-oxazole-3,4-dicarboxamide (CID 67849858) is 1,2-oxazole-3,4-dicarboxamide.
What is the SMILES notation for 1,2-oxazole-3,4-dicarboxamide?
The canonical SMILES for 1,2-oxazole-3,4-dicarboxamide is NC(=O)c1conc1C(N)=O.
What is the InChIKey of 1,2-oxazole-3,4-dicarboxamide?
The InChIKey is CCCKDAJIRSOBGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N3O3/c6-4(9)2-1-11-8-3(2)5(7)10/h1H,(H2,6,9)(H2,7,10).
What are the key properties of 1,2-oxazole-3,4-dicarboxamide?
1,2-oxazole-3,4-dicarboxamide has a molecular weight of 155.11 g/mol, XLogP of -1.13, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-oxazole-3,4-dicarboxamide is sourced from PubChem (CID 67849858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).