C18H19N3O3S2 — CID 67849871
4-[[4-[[(2S)-1-(1,3-thiazol-2-yl)pyrrolidin-2-yl]methoxy]phenyl]methyl]-1,3-thiazolidine-2,5-dione (PubChem CID 67849871) has the molecular formula C18H19N3O3S2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 4-[[4-[[(2S)-1-(1,3-thiazol-2-yl)pyrrolidin-2-yl]methoxy]phenyl]methyl]-1,3-thiazolidine-2,5-dione.
| Compound Name | 4-[[4-[[(2S)-1-(1,3-thiazol-2-yl)pyrrolidin-2-yl]methoxy]phenyl]methyl]-1,3-thiazolidine-2,5-dione |
|---|---|
| PubChem CID | 67849871 |
| Molecular Formula | C18H19N3O3S2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 4-[[4-[[(2S)-1-(1,3-thiazol-2-yl)pyrrolidin-2-yl]methoxy]phenyl]methyl]-1,3-thiazolidine-2,5-dione |
| SMILES | O=C1NC(Cc2ccc(OC[C@@H]3CCCN3c3nccs3)cc2)C(=O)S1 |
| InChI | InChI=1S/C18H19N3O3S2/c22-16-15(20-18(23)26-16)10-12-3-5-14(6-4-12)24-11-13-2-1-8-21(13)17-19-7-9-25-17/h3-7,9,13,15H,1-2,8,10-11H2,(H,20,23)/t13-,15?/m0/s1 |
| InChIKey | SKJUEMFGNJETCJ-CFMCSPIPSA-N |
| XLogP | 3.09 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|