About 5-bromo-1-methyl-4,7-dihydro-3H-purine-2,6-dione
5-bromo-1-methyl-4,7-dihydro-3H-purine-2,6-dione (PubChem CID 67850077) has the molecular formula C6H7BrN4O2
and a molecular weight of 247.05 g/mol. Its IUPAC name is 5-bromo-1-methyl-4,7-dihydro-3H-purine-2,6-dione.
Molecular Properties
| Compound Name | 5-bromo-1-methyl-4,7-dihydro-3H-purine-2,6-dione |
| PubChem CID | 67850077 |
| Molecular Formula | C6H7BrN4O2 |
| Molecular Weight | 247.05 g/mol |
| Exact Mass | 245.98 |
| IUPAC Name | 5-bromo-1-methyl-4,7-dihydro-3H-purine-2,6-dione |
| SMILES | CN1C(=O)NC2N=CNC2(Br)C1=O |
| InChI | InChI=1S/C6H7BrN4O2/c1-11-4(12)6(7)3(8-2-9-6)10-5(11)13/h2-3H,1H3,(H,8,9)(H,10,13) |
| InChIKey | WNLJTQZOQXMLFC-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.05 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-1-methyl-4,7-dihydro-3H-purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1-methyl-4,7-dihydro-3H-purine-2,6-dione?
The IUPAC name of 5-bromo-1-methyl-4,7-dihydro-3H-purine-2,6-dione (CID 67850077) is 5-bromo-1-methyl-4,7-dihydro-3H-purine-2,6-dione.
What is the SMILES notation for 5-bromo-1-methyl-4,7-dihydro-3H-purine-2,6-dione?
The canonical SMILES for 5-bromo-1-methyl-4,7-dihydro-3H-purine-2,6-dione is CN1C(=O)NC2N=CNC2(Br)C1=O.
What is the InChIKey of 5-bromo-1-methyl-4,7-dihydro-3H-purine-2,6-dione?
The InChIKey is WNLJTQZOQXMLFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7BrN4O2/c1-11-4(12)6(7)3(8-2-9-6)10-5(11)13/h2-3H,1H3,(H,8,9)(H,10,13).
What are the key properties of 5-bromo-1-methyl-4,7-dihydro-3H-purine-2,6-dione?
5-bromo-1-methyl-4,7-dihydro-3H-purine-2,6-dione has a molecular weight of 247.05 g/mol, XLogP of -0.78, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1-methyl-4,7-dihydro-3H-purine-2,6-dione is sourced from PubChem (CID 67850077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).