About 5-bromo-1-propyl-4,7-dihydro-3H-purine-2,6-dione
5-bromo-1-propyl-4,7-dihydro-3H-purine-2,6-dione (PubChem CID 67850107) has the molecular formula C8H11BrN4O2
and a molecular weight of 275.11 g/mol. Its IUPAC name is 5-bromo-1-propyl-4,7-dihydro-3H-purine-2,6-dione.
Molecular Properties
| Compound Name | 5-bromo-1-propyl-4,7-dihydro-3H-purine-2,6-dione |
| PubChem CID | 67850107 |
| Molecular Formula | C8H11BrN4O2 |
| Molecular Weight | 275.11 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | 5-bromo-1-propyl-4,7-dihydro-3H-purine-2,6-dione |
| SMILES | CCCN1C(=O)NC2N=CNC2(Br)C1=O |
| InChI | InChI=1S/C8H11BrN4O2/c1-2-3-13-6(14)8(9)5(10-4-11-8)12-7(13)15/h4-5H,2-3H2,1H3,(H,10,11)(H,12,15) |
| InChIKey | VXMQKAZWIXFZEW-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.11 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-1-propyl-4,7-dihydro-3H-purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1-propyl-4,7-dihydro-3H-purine-2,6-dione?
The IUPAC name of 5-bromo-1-propyl-4,7-dihydro-3H-purine-2,6-dione (CID 67850107) is 5-bromo-1-propyl-4,7-dihydro-3H-purine-2,6-dione.
What is the SMILES notation for 5-bromo-1-propyl-4,7-dihydro-3H-purine-2,6-dione?
The canonical SMILES for 5-bromo-1-propyl-4,7-dihydro-3H-purine-2,6-dione is CCCN1C(=O)NC2N=CNC2(Br)C1=O.
What is the InChIKey of 5-bromo-1-propyl-4,7-dihydro-3H-purine-2,6-dione?
The InChIKey is VXMQKAZWIXFZEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11BrN4O2/c1-2-3-13-6(14)8(9)5(10-4-11-8)12-7(13)15/h4-5H,2-3H2,1H3,(H,10,11)(H,12,15).
What are the key properties of 5-bromo-1-propyl-4,7-dihydro-3H-purine-2,6-dione?
5-bromo-1-propyl-4,7-dihydro-3H-purine-2,6-dione has a molecular weight of 275.11 g/mol, XLogP of -0.00, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1-propyl-4,7-dihydro-3H-purine-2,6-dione is sourced from PubChem (CID 67850107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).