About 1-[2-prop-1-enyl-5-(1,3,3-trimethylindol-2-ylidene)-2H-thiophen-3-yl]ethanone
1-[2-prop-1-enyl-5-(1,3,3-trimethylindol-2-ylidene)-2H-thiophen-3-yl]ethanone (PubChem CID 67850162) has the molecular formula C20H23NOS
and a molecular weight of 325.48 g/mol. Its IUPAC name is 1-[2-prop-1-enyl-5-(1,3,3-trimethylindol-2-ylidene)-2H-thiophen-3-yl]ethanone.
Molecular Properties
| Compound Name | 1-[2-prop-1-enyl-5-(1,3,3-trimethylindol-2-ylidene)-2H-thiophen-3-yl]ethanone |
| PubChem CID | 67850162 |
| Molecular Formula | C20H23NOS |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 1-[2-prop-1-enyl-5-(1,3,3-trimethylindol-2-ylidene)-2H-thiophen-3-yl]ethanone |
| SMILES | CC=CC1SC(=C2N(C)c3ccccc3C2(C)C)C=C1C(C)=O |
| InChI | InChI=1S/C20H23NOS/c1-6-9-17-14(13(2)22)12-18(23-17)19-20(3,4)15-10-7-8-11-16(15)21(19)5/h6-12,17H,1-5H3 |
| InChIKey | DDRQJPYUTCPZRZ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-prop-1-enyl-5-(1,3,3-trimethylindol-2-ylidene)-2H-thiophen-3-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-prop-1-enyl-5-(1,3,3-trimethylindol-2-ylidene)-2H-thiophen-3-yl]ethanone?
The IUPAC name of 1-[2-prop-1-enyl-5-(1,3,3-trimethylindol-2-ylidene)-2H-thiophen-3-yl]ethanone (CID 67850162) is 1-[2-prop-1-enyl-5-(1,3,3-trimethylindol-2-ylidene)-2H-thiophen-3-yl]ethanone.
What is the SMILES notation for 1-[2-prop-1-enyl-5-(1,3,3-trimethylindol-2-ylidene)-2H-thiophen-3-yl]ethanone?
The canonical SMILES for 1-[2-prop-1-enyl-5-(1,3,3-trimethylindol-2-ylidene)-2H-thiophen-3-yl]ethanone is CC=CC1SC(=C2N(C)c3ccccc3C2(C)C)C=C1C(C)=O.
What is the InChIKey of 1-[2-prop-1-enyl-5-(1,3,3-trimethylindol-2-ylidene)-2H-thiophen-3-yl]ethanone?
The InChIKey is DDRQJPYUTCPZRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23NOS/c1-6-9-17-14(13(2)22)12-18(23-17)19-20(3,4)15-10-7-8-11-16(15)21(19)5/h6-12,17H,1-5H3.
What are the key properties of 1-[2-prop-1-enyl-5-(1,3,3-trimethylindol-2-ylidene)-2H-thiophen-3-yl]ethanone?
1-[2-prop-1-enyl-5-(1,3,3-trimethylindol-2-ylidene)-2H-thiophen-3-yl]ethanone has a molecular weight of 325.48 g/mol, XLogP of 4.83, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-prop-1-enyl-5-(1,3,3-trimethylindol-2-ylidene)-2H-thiophen-3-yl]ethanone is sourced from PubChem (CID 67850162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).