C32H32N4 — CID 67850296
2,12-bis(ethenyl)-7,17-diethyl-3,8,13,18-tetramethylporphyrin (PubChem CID 67850296) has the molecular formula C32H32N4 and a molecular weight of 472.64 g/mol. Its IUPAC name is 2,12-bis(ethenyl)-7,17-diethyl-3,8,13,18-tetramethylporphyrin.
| Compound Name | 2,12-bis(ethenyl)-7,17-diethyl-3,8,13,18-tetramethylporphyrin |
|---|---|
| PubChem CID | 67850296 |
| Molecular Formula | C32H32N4 |
| Molecular Weight | 472.64 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | 2,12-bis(ethenyl)-7,17-diethyl-3,8,13,18-tetramethylporphyrin |
| SMILES | C=CC1=C(C)/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C(C)=C5CC)C(C)=C4C=C)C(C)=C3CC |
| InChI | InChI=1S/C32H32N4/c1-9-21-17(5)25-14-30-23(11-3)19(7)27(35-30)16-32-24(12-4)20(8)28(36-32)15-31-22(10-2)18(6)26(34-31)13-29(21)33-25/h9,12-16H,1,4,10-11H2,2-3,5-8H3/b25-14-,26-13-,27-16-,28-15-,29-13-,30-14-,31-15-,32-16- |
| InChIKey | OMFKLWBRXRYEBI-GCISPZHASA-N |
| XLogP | 7.81 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.64 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |