C20H24N2O6 — CID 67850372
but-2-enedioic acid;6-(3,4-dimethoxyphenyl)-1-methyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine (PubChem CID 67850372) has the molecular formula C20H24N2O6 and a molecular weight of 388.42 g/mol. Its IUPAC name is but-2-enedioic acid;6-(3,4-dimethoxyphenyl)-1-methyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine.
| Compound Name | but-2-enedioic acid;6-(3,4-dimethoxyphenyl)-1-methyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 67850372 |
| Molecular Formula | C20H24N2O6 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | but-2-enedioic acid;6-(3,4-dimethoxyphenyl)-1-methyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine |
| SMILES | COc1ccc(-c2ccc3n2CCNC3C)cc1OC.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C16H20N2O2.C4H4O4/c1-11-13-5-6-14(18(13)9-8-17-11)12-4-7-15(19-2)16(10-12)20-3;5-3(6)1-2-4(7)8/h4-7,10-11,17H,8-9H2,1-3H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | NCNSQTVZJFNVBP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|