C12H20O6 — CID 67850389
3a-(hydroxymethyl)-6-(methoxymethoxy)-7,7a-dimethyl-6,7-dihydro-5H-1,3-benzodioxol-4-one (PubChem CID 67850389) has the molecular formula C12H20O6 and a molecular weight of 260.29 g/mol. Its IUPAC name is 3a-(hydroxymethyl)-6-(methoxymethoxy)-7,7a-dimethyl-6,7-dihydro-5H-1,3-benzodioxol-4-one.
| Compound Name | 3a-(hydroxymethyl)-6-(methoxymethoxy)-7,7a-dimethyl-6,7-dihydro-5H-1,3-benzodioxol-4-one |
|---|---|
| PubChem CID | 67850389 |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 3a-(hydroxymethyl)-6-(methoxymethoxy)-7,7a-dimethyl-6,7-dihydro-5H-1,3-benzodioxol-4-one |
| SMILES | COCOC1CC(=O)C2(CO)OCOC2(C)C1C |
| InChI | InChI=1S/C12H20O6/c1-8-9(16-6-15-3)4-10(14)12(5-13)11(8,2)17-7-18-12/h8-9,13H,4-7H2,1-3H3 |
| InChIKey | HXLLKLCXGGSJHE-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|