About 2-[4-[5-(2-aminoethyl)thiophen-2-yl]-1,3-thiazol-2-yl]guanidine;dihydrochloride
2-[4-[5-(2-aminoethyl)thiophen-2-yl]-1,3-thiazol-2-yl]guanidine;dihydrochloride (PubChem CID 67850414) has the molecular formula C10H15Cl2N5S2
and a molecular weight of 340.31 g/mol. Its IUPAC name is 2-[4-[5-(2-aminoethyl)thiophen-2-yl]-1,3-thiazol-2-yl]guanidine;dihydrochloride.
Molecular Properties
| Compound Name | 2-[4-[5-(2-aminoethyl)thiophen-2-yl]-1,3-thiazol-2-yl]guanidine;dihydrochloride |
| PubChem CID | 67850414 |
| Molecular Formula | C10H15Cl2N5S2 |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 2-[4-[5-(2-aminoethyl)thiophen-2-yl]-1,3-thiazol-2-yl]guanidine;dihydrochloride |
| SMILES | Cl.Cl.NCCc1ccc(-c2csc(N=C(N)N)n2)s1 |
| InChI | InChI=1S/C10H13N5S2.2ClH/c11-4-3-6-1-2-8(17-6)7-5-16-10(14-7)15-9(12)13;;/h1-2,5H,3-4,11H2,(H4,12,13,14,15);2*1H |
| InChIKey | NURGUBZTEDFQGM-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 103.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[5-(2-aminoethyl)thiophen-2-yl]-1,3-thiazol-2-yl]guanidine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[5-(2-aminoethyl)thiophen-2-yl]-1,3-thiazol-2-yl]guanidine;dihydrochloride?
The IUPAC name of 2-[4-[5-(2-aminoethyl)thiophen-2-yl]-1,3-thiazol-2-yl]guanidine;dihydrochloride (CID 67850414) is 2-[4-[5-(2-aminoethyl)thiophen-2-yl]-1,3-thiazol-2-yl]guanidine;dihydrochloride.
What is the SMILES notation for 2-[4-[5-(2-aminoethyl)thiophen-2-yl]-1,3-thiazol-2-yl]guanidine;dihydrochloride?
The canonical SMILES for 2-[4-[5-(2-aminoethyl)thiophen-2-yl]-1,3-thiazol-2-yl]guanidine;dihydrochloride is Cl.Cl.NCCc1ccc(-c2csc(N=C(N)N)n2)s1.
What is the InChIKey of 2-[4-[5-(2-aminoethyl)thiophen-2-yl]-1,3-thiazol-2-yl]guanidine;dihydrochloride?
The InChIKey is NURGUBZTEDFQGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N5S2.2ClH/c11-4-3-6-1-2-8(17-6)7-5-16-10(14-7)15-9(12)13;;/h1-2,5H,3-4,11H2,(H4,12,13,14,15);2*1H.
What are the key properties of 2-[4-[5-(2-aminoethyl)thiophen-2-yl]-1,3-thiazol-2-yl]guanidine;dihydrochloride?
2-[4-[5-(2-aminoethyl)thiophen-2-yl]-1,3-thiazol-2-yl]guanidine;dihydrochloride has a molecular weight of 340.31 g/mol, XLogP of 2.12, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[5-(2-aminoethyl)thiophen-2-yl]-1,3-thiazol-2-yl]guanidine;dihydrochloride is sourced from PubChem (CID 67850414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).