About methyl 4-[6-(1H-indol-5-yl)-3-pyridinyl]-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate
methyl 4-[6-(1H-indol-5-yl)-3-pyridinyl]-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate (PubChem CID 67851159) has the molecular formula C22H21N3O2
and a molecular weight of 359.43 g/mol. Its IUPAC name is methyl 4-[6-(1H-indol-5-yl)-3-pyridinyl]-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 4-[6-(1H-indol-5-yl)-3-pyridinyl]-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate |
| PubChem CID | 67851159 |
| Molecular Formula | C22H21N3O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | methyl 4-[6-(1H-indol-5-yl)-3-pyridinyl]-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=CC1c1ccc(-c2ccc3[nH]ccc3c2)nc1 |
| InChI | InChI=1S/C22H21N3O2/c1-13-10-18(21(14(2)25-13)22(26)27-3)17-5-7-20(24-12-17)15-4-6-19-16(11-15)8-9-23-19/h4-12,18,23,25H,1-3H3 |
| InChIKey | PJKZQBBDMYPGSA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-[6-(1H-indol-5-yl)-3-pyridinyl]-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[6-(1H-indol-5-yl)-3-pyridinyl]-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate?
The IUPAC name of methyl 4-[6-(1H-indol-5-yl)-3-pyridinyl]-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate (CID 67851159) is methyl 4-[6-(1H-indol-5-yl)-3-pyridinyl]-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate.
What is the SMILES notation for methyl 4-[6-(1H-indol-5-yl)-3-pyridinyl]-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate?
The canonical SMILES for methyl 4-[6-(1H-indol-5-yl)-3-pyridinyl]-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate is COC(=O)C1=C(C)NC(C)=CC1c1ccc(-c2ccc3[nH]ccc3c2)nc1.
What is the InChIKey of methyl 4-[6-(1H-indol-5-yl)-3-pyridinyl]-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate?
The InChIKey is PJKZQBBDMYPGSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N3O2/c1-13-10-18(21(14(2)25-13)22(26)27-3)17-5-7-20(24-12-17)15-4-6-19-16(11-15)8-9-23-19/h4-12,18,23,25H,1-3H3.
What are the key properties of methyl 4-[6-(1H-indol-5-yl)-3-pyridinyl]-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate?
methyl 4-[6-(1H-indol-5-yl)-3-pyridinyl]-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate has a molecular weight of 359.43 g/mol, XLogP of 4.27, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[6-(1H-indol-5-yl)-3-pyridinyl]-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate is sourced from PubChem (CID 67851159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).