About methyl 2,6-dimethyl-4-[6-(4-methylphenyl)-3-pyridinyl]-1,4-dihydropyridine-3-carboxylate
methyl 2,6-dimethyl-4-[6-(4-methylphenyl)-3-pyridinyl]-1,4-dihydropyridine-3-carboxylate (PubChem CID 67851168) has the molecular formula C21H22N2O2
and a molecular weight of 334.42 g/mol. Its IUPAC name is methyl 2,6-dimethyl-4-[6-(4-methylphenyl)-3-pyridinyl]-1,4-dihydropyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 2,6-dimethyl-4-[6-(4-methylphenyl)-3-pyridinyl]-1,4-dihydropyridine-3-carboxylate |
| PubChem CID | 67851168 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | methyl 2,6-dimethyl-4-[6-(4-methylphenyl)-3-pyridinyl]-1,4-dihydropyridine-3-carboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=CC1c1ccc(-c2ccc(C)cc2)nc1 |
| InChI | InChI=1S/C21H22N2O2/c1-13-5-7-16(8-6-13)19-10-9-17(12-22-19)18-11-14(2)23-15(3)20(18)21(24)25-4/h5-12,18,23H,1-4H3 |
| InChIKey | MKRYFIMUBHPDPD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2,6-dimethyl-4-[6-(4-methylphenyl)-3-pyridinyl]-1,4-dihydropyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2,6-dimethyl-4-[6-(4-methylphenyl)-3-pyridinyl]-1,4-dihydropyridine-3-carboxylate?
The IUPAC name of methyl 2,6-dimethyl-4-[6-(4-methylphenyl)-3-pyridinyl]-1,4-dihydropyridine-3-carboxylate (CID 67851168) is methyl 2,6-dimethyl-4-[6-(4-methylphenyl)-3-pyridinyl]-1,4-dihydropyridine-3-carboxylate.
What is the SMILES notation for methyl 2,6-dimethyl-4-[6-(4-methylphenyl)-3-pyridinyl]-1,4-dihydropyridine-3-carboxylate?
The canonical SMILES for methyl 2,6-dimethyl-4-[6-(4-methylphenyl)-3-pyridinyl]-1,4-dihydropyridine-3-carboxylate is COC(=O)C1=C(C)NC(C)=CC1c1ccc(-c2ccc(C)cc2)nc1.
What is the InChIKey of methyl 2,6-dimethyl-4-[6-(4-methylphenyl)-3-pyridinyl]-1,4-dihydropyridine-3-carboxylate?
The InChIKey is MKRYFIMUBHPDPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O2/c1-13-5-7-16(8-6-13)19-10-9-17(12-22-19)18-11-14(2)23-15(3)20(18)21(24)25-4/h5-12,18,23H,1-4H3.
What are the key properties of methyl 2,6-dimethyl-4-[6-(4-methylphenyl)-3-pyridinyl]-1,4-dihydropyridine-3-carboxylate?
methyl 2,6-dimethyl-4-[6-(4-methylphenyl)-3-pyridinyl]-1,4-dihydropyridine-3-carboxylate has a molecular weight of 334.42 g/mol, XLogP of 4.09, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,6-dimethyl-4-[6-(4-methylphenyl)-3-pyridinyl]-1,4-dihydropyridine-3-carboxylate is sourced from PubChem (CID 67851168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).