About 2-(iodomethyl)-7-methylsulfanyl-3,4,5,6-tetrahydro-2H-azepine
2-(iodomethyl)-7-methylsulfanyl-3,4,5,6-tetrahydro-2H-azepine (PubChem CID 67851466) has the molecular formula C8H14INS
and a molecular weight of 283.18 g/mol. Its IUPAC name is 2-(iodomethyl)-7-methylsulfanyl-3,4,5,6-tetrahydro-2H-azepine.
Molecular Properties
| Compound Name | 2-(iodomethyl)-7-methylsulfanyl-3,4,5,6-tetrahydro-2H-azepine |
| PubChem CID | 67851466 |
| Molecular Formula | C8H14INS |
| Molecular Weight | 283.18 g/mol |
| Exact Mass | 282.99 |
| IUPAC Name | 2-(iodomethyl)-7-methylsulfanyl-3,4,5,6-tetrahydro-2H-azepine |
| SMILES | CSC1=NC(CI)CCCC1 |
| InChI | InChI=1S/C8H14INS/c1-11-8-5-3-2-4-7(6-9)10-8/h7H,2-6H2,1H3 |
| InChIKey | HZALTGMEYUBJKP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.18 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(iodomethyl)-7-methylsulfanyl-3,4,5,6-tetrahydro-2H-azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(iodomethyl)-7-methylsulfanyl-3,4,5,6-tetrahydro-2H-azepine?
The IUPAC name of 2-(iodomethyl)-7-methylsulfanyl-3,4,5,6-tetrahydro-2H-azepine (CID 67851466) is 2-(iodomethyl)-7-methylsulfanyl-3,4,5,6-tetrahydro-2H-azepine.
What is the SMILES notation for 2-(iodomethyl)-7-methylsulfanyl-3,4,5,6-tetrahydro-2H-azepine?
The canonical SMILES for 2-(iodomethyl)-7-methylsulfanyl-3,4,5,6-tetrahydro-2H-azepine is CSC1=NC(CI)CCCC1.
What is the InChIKey of 2-(iodomethyl)-7-methylsulfanyl-3,4,5,6-tetrahydro-2H-azepine?
The InChIKey is HZALTGMEYUBJKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14INS/c1-11-8-5-3-2-4-7(6-9)10-8/h7H,2-6H2,1H3.
What are the key properties of 2-(iodomethyl)-7-methylsulfanyl-3,4,5,6-tetrahydro-2H-azepine?
2-(iodomethyl)-7-methylsulfanyl-3,4,5,6-tetrahydro-2H-azepine has a molecular weight of 283.18 g/mol, XLogP of 3.13, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(iodomethyl)-7-methylsulfanyl-3,4,5,6-tetrahydro-2H-azepine is sourced from PubChem (CID 67851466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).