C25H36N4O6S2 — CID 67851711
1-[4-[[4-[carbamoyl(pentylsulfonyl)amino]phenyl]methyl]phenyl]-1-pentylsulfonylurea (PubChem CID 67851711) has the molecular formula C25H36N4O6S2 and a molecular weight of 552.72 g/mol. Its IUPAC name is 1-[4-[[4-[carbamoyl(pentylsulfonyl)amino]phenyl]methyl]phenyl]-1-pentylsulfonylurea.
| Compound Name | 1-[4-[[4-[carbamoyl(pentylsulfonyl)amino]phenyl]methyl]phenyl]-1-pentylsulfonylurea |
|---|---|
| PubChem CID | 67851711 |
| Molecular Formula | C25H36N4O6S2 |
| Molecular Weight | 552.72 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | 1-[4-[[4-[carbamoyl(pentylsulfonyl)amino]phenyl]methyl]phenyl]-1-pentylsulfonylurea |
| SMILES | CCCCCS(=O)(=O)N(C(N)=O)c1ccc(Cc2ccc(N(C(N)=O)S(=O)(=O)CCCCC)cc2)cc1 |
| InChI | InChI=1S/C25H36N4O6S2/c1-3-5-7-17-36(32,33)28(24(26)30)22-13-9-20(10-14-22)19-21-11-15-23(16-12-21)29(25(27)31)37(34,35)18-8-6-4-2/h9-16H,3-8,17-19H2,1-2H3,(H2,26,30)(H2,27,31) |
| InChIKey | WBAUJMOVXXPDEB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 160.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.72 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|