About 2-(1-piperidin-1-ylprop-2-enyl)-1,2-benzoxazine
2-(1-piperidin-1-ylprop-2-enyl)-1,2-benzoxazine (PubChem CID 67851901) has the molecular formula C16H20N2O
and a molecular weight of 256.35 g/mol. Its IUPAC name is 2-(1-piperidin-1-ylprop-2-enyl)-1,2-benzoxazine.
Molecular Properties
| Compound Name | 2-(1-piperidin-1-ylprop-2-enyl)-1,2-benzoxazine |
| PubChem CID | 67851901 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 2-(1-piperidin-1-ylprop-2-enyl)-1,2-benzoxazine |
| SMILES | C=CC(N1CCCCC1)N1C=Cc2ccccc2O1 |
| InChI | InChI=1S/C16H20N2O/c1-2-16(17-11-6-3-7-12-17)18-13-10-14-8-4-5-9-15(14)19-18/h2,4-5,8-10,13,16H,1,3,6-7,11-12H2 |
| InChIKey | RITLPIGTIOVNFL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-piperidin-1-ylprop-2-enyl)-1,2-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-piperidin-1-ylprop-2-enyl)-1,2-benzoxazine?
The IUPAC name of 2-(1-piperidin-1-ylprop-2-enyl)-1,2-benzoxazine (CID 67851901) is 2-(1-piperidin-1-ylprop-2-enyl)-1,2-benzoxazine.
What is the SMILES notation for 2-(1-piperidin-1-ylprop-2-enyl)-1,2-benzoxazine?
The canonical SMILES for 2-(1-piperidin-1-ylprop-2-enyl)-1,2-benzoxazine is C=CC(N1CCCCC1)N1C=Cc2ccccc2O1.
What is the InChIKey of 2-(1-piperidin-1-ylprop-2-enyl)-1,2-benzoxazine?
The InChIKey is RITLPIGTIOVNFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O/c1-2-16(17-11-6-3-7-12-17)18-13-10-14-8-4-5-9-15(14)19-18/h2,4-5,8-10,13,16H,1,3,6-7,11-12H2.
What are the key properties of 2-(1-piperidin-1-ylprop-2-enyl)-1,2-benzoxazine?
2-(1-piperidin-1-ylprop-2-enyl)-1,2-benzoxazine has a molecular weight of 256.35 g/mol, XLogP of 3.26, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-piperidin-1-ylprop-2-enyl)-1,2-benzoxazine is sourced from PubChem (CID 67851901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).