About 1,3-dioxolane;thiolane 1,1-dioxide
1,3-dioxolane;thiolane 1,1-dioxide (PubChem CID 67851911) has the molecular formula C7H14O4S
and a molecular weight of 194.25 g/mol. Its IUPAC name is 1,3-dioxolane;thiolane 1,1-dioxide.
Molecular Properties
| Compound Name | 1,3-dioxolane;thiolane 1,1-dioxide |
| PubChem CID | 67851911 |
| Molecular Formula | C7H14O4S |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 1,3-dioxolane;thiolane 1,1-dioxide |
| SMILES | C1COCO1.O=S1(=O)CCCC1 |
| InChI | InChI=1S/C4H8O2S.C3H6O2/c5-7(6)3-1-2-4-7;1-2-5-3-4-1/h1-4H2;1-3H2 |
| InChIKey | FTGRDSJQJIGKBV-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,3-dioxolane;thiolane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dioxolane;thiolane 1,1-dioxide?
The IUPAC name of 1,3-dioxolane;thiolane 1,1-dioxide (CID 67851911) is 1,3-dioxolane;thiolane 1,1-dioxide.
What is the SMILES notation for 1,3-dioxolane;thiolane 1,1-dioxide?
The canonical SMILES for 1,3-dioxolane;thiolane 1,1-dioxide is C1COCO1.O=S1(=O)CCCC1.
What is the InChIKey of 1,3-dioxolane;thiolane 1,1-dioxide?
The InChIKey is FTGRDSJQJIGKBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O2S.C3H6O2/c5-7(6)3-1-2-4-7;1-2-5-3-4-1/h1-4H2;1-3H2.
What are the key properties of 1,3-dioxolane;thiolane 1,1-dioxide?
1,3-dioxolane;thiolane 1,1-dioxide has a molecular weight of 194.25 g/mol, XLogP of 0.19, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dioxolane;thiolane 1,1-dioxide is sourced from PubChem (CID 67851911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).