C13H14N4 — CID 67851997
2,5-diethyl-1H-imidazo[4,5-b]quinoxaline (PubChem CID 67851997) has the molecular formula C13H14N4 and a molecular weight of 226.28 g/mol. Its IUPAC name is 2,5-diethyl-1H-imidazo[4,5-b]quinoxaline.
| Compound Name | 2,5-diethyl-1H-imidazo[4,5-b]quinoxaline |
|---|---|
| PubChem CID | 67851997 |
| Molecular Formula | C13H14N4 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 2,5-diethyl-1H-imidazo[4,5-b]quinoxaline |
| SMILES | CCc1nc2nc3c(CC)cccc3nc2[nH]1 |
| InChI | InChI=1S/C13H14N4/c1-3-8-6-5-7-9-11(8)17-13-12(14-9)15-10(4-2)16-13/h5-7H,3-4H2,1-2H3,(H,14,15,16,17) |
| InChIKey | IKCZRROJQTVAMT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |