C21H20N4 — CID 678520
(7S,7aR)-5-amino-7-(2,4,6-trimethylphenyl)-1,2,7,7a-tetrahydroindene-4,6,6-tricarbonitrile (PubChem CID 678520) has the molecular formula C21H20N4 and a molecular weight of 328.42 g/mol. Its IUPAC name is (7S,7aR)-5-amino-7-(2,4,6-trimethylphenyl)-1,2,7,7a-tetrahydroindene-4,6,6-tricarbonitrile.
| Compound Name | (7S,7aR)-5-amino-7-(2,4,6-trimethylphenyl)-1,2,7,7a-tetrahydroindene-4,6,6-tricarbonitrile |
|---|---|
| PubChem CID | 678520 |
| Molecular Formula | C21H20N4 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (7S,7aR)-5-amino-7-(2,4,6-trimethylphenyl)-1,2,7,7a-tetrahydroindene-4,6,6-tricarbonitrile |
| SMILES | Cc1cc(C)c([C@@H]2[C@H]3CCC=C3C(C#N)=C(N)C2(C#N)C#N)c(C)c1 |
| InChI | InChI=1S/C21H20N4/c1-12-7-13(2)18(14(3)8-12)19-16-6-4-5-15(16)17(9-22)20(25)21(19,10-23)11-24/h5,7-8,16,19H,4,6,25H2,1-3H3/t16-,19-/m0/s1 |
| InChIKey | QWKHHQOBOXPDAH-LPHOPBHVSA-N |
| XLogP | 3.82 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|