C14H11NO2 — CID 67852024
methyl 6-azatricyclo[6.4.1.04,13]trideca-1(13),2,4,7,9,11-hexaene-2-carboxylate (PubChem CID 67852024) has the molecular formula C14H11NO2 and a molecular weight of 225.25 g/mol. Its IUPAC name is methyl 6-azatricyclo[6.4.1.04,13]trideca-1(13),2,4,7,9,11-hexaene-2-carboxylate.
| Compound Name | methyl 6-azatricyclo[6.4.1.04,13]trideca-1(13),2,4,7,9,11-hexaene-2-carboxylate |
|---|---|
| PubChem CID | 67852024 |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | methyl 6-azatricyclo[6.4.1.04,13]trideca-1(13),2,4,7,9,11-hexaene-2-carboxylate |
| SMILES | COC(=O)c1cc2c[nH]cc3ccccc1c32 |
| InChI | InChI=1S/C14H11NO2/c1-17-14(16)12-6-10-8-15-7-9-4-2-3-5-11(12)13(9)10/h2-8,15H,1H3 |
| InChIKey | JVEOJIYBNFYVDU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azulene(4)', 'substructure': 'N/A'} |
|---|