C36H44N4 — CID 67852147
2,3,5,7-tetrabutylporphyrin (PubChem CID 67852147) has the molecular formula C36H44N4 and a molecular weight of 532.78 g/mol. Its IUPAC name is 2,3,5,7-tetrabutylporphyrin.
| Compound Name | 2,3,5,7-tetrabutylporphyrin |
|---|---|
| PubChem CID | 67852147 |
| Molecular Formula | C36H44N4 |
| Molecular Weight | 532.78 g/mol |
| Exact Mass | 532.36 |
| IUPAC Name | 2,3,5,7-tetrabutylporphyrin |
| SMILES | CCCCC1=C/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C(/CCCC)C1=N2)C(CCCC)=C5CCCC)C=C4)C=C3 |
| InChI | InChI=1S/C36H44N4/c1-5-9-13-25-21-30-23-28-18-17-26(37-28)22-27-19-20-29(38-27)24-34-31(14-10-6-2)32(15-11-7-3)36(40-34)33(16-12-8-4)35(25)39-30/h17-24H,5-16H2,1-4H3/b26-22-,27-22-,28-23-,29-24-,30-23-,34-24-,35-33-,36-33- |
| InChIKey | GUSSITREVRKXDC-SEVULKBASA-N |
| XLogP | 9.82 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.78 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |