C32H58N4O6 — CID 67852791
[4-[acetyl-[6-[acetyl-(1-acetyloxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl]amino]-2,2,6,6-tetramethylpiperidin-1-yl] acetate (PubChem CID 67852791) has the molecular formula C32H58N4O6 and a molecular weight of 594.84 g/mol. Its IUPAC name is [4-[acetyl-[6-[acetyl-(1-acetyloxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl]amino]-2,2,6,6-tetramethylpiperidin-1-yl] acetate.
| Compound Name | [4-[acetyl-[6-[acetyl-(1-acetyloxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl]amino]-2,2,6,6-tetramethylpiperidin-1-yl] acetate |
|---|---|
| PubChem CID | 67852791 |
| Molecular Formula | C32H58N4O6 |
| Molecular Weight | 594.84 g/mol |
| Exact Mass | 594.44 |
| IUPAC Name | [4-[acetyl-[6-[acetyl-(1-acetyloxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl]amino]-2,2,6,6-tetramethylpiperidin-1-yl] acetate |
| SMILES | CC(=O)ON1C(C)(C)CC(N(CCCCCCN(C(C)=O)C2CC(C)(C)N(OC(C)=O)C(C)(C)C2)C(C)=O)CC1(C)C |
| InChI | InChI=1S/C32H58N4O6/c1-23(37)33(27-19-29(5,6)35(41-25(3)39)30(7,8)20-27)17-15-13-14-16-18-34(24(2)38)28-21-31(9,10)36(42-26(4)40)32(11,12)22-28/h27-28H,13-22H2,1-12H3 |
| InChIKey | XNAVTWBHCGEXCF-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 99.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.84 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|