C26H42O6 — CID 67853007
(1S,3R,7S,8S,9S,10R,13S,14S,17R)-17-[1-(1,3-dioxolan-2-yl)ethyl]-3-(methoxymethoxy)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-1,7-diol (PubChem CID 67853007) has the molecular formula C26H42O6 and a molecular weight of 450.62 g/mol. Its IUPAC name is (1S,3R,7S,8S,9S,10R,13S,14S,17R)-17-[1-(1,3-dioxolan-2-yl)ethyl]-3-(methoxymethoxy)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-1,7-diol.
| Compound Name | (1S,3R,7S,8S,9S,10R,13S,14S,17R)-17-[1-(1,3-dioxolan-2-yl)ethyl]-3-(methoxymethoxy)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-1,7-diol |
|---|---|
| PubChem CID | 67853007 |
| Molecular Formula | C26H42O6 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | (1S,3R,7S,8S,9S,10R,13S,14S,17R)-17-[1-(1,3-dioxolan-2-yl)ethyl]-3-(methoxymethoxy)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-1,7-diol |
| SMILES | COCO[C@@H]1CC2=C[C@@H](O)[C@H]3[C@@H]4CC[C@H](C(C)C5OCCO5)[C@@]4(C)CC[C@@H]3[C@@]2(C)[C@@H](O)C1 |
| InChI | InChI=1S/C26H42O6/c1-15(24-30-9-10-31-24)18-5-6-19-23-20(7-8-25(18,19)2)26(3)16(12-21(23)27)11-17(13-22(26)28)32-14-29-4/h12,15,17-24,27-28H,5-11,13-14H2,1-4H3/t15?,17-,18-,19+,20+,21-,22+,23+,25-,26+/m1/s1 |
| InChIKey | HNPYHVKZVAPEFV-QFNZYNFUSA-N |
| XLogP | 3.51 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|