C34H50O4 — CID 67853036
4-[4-[(2S,4R,5S)-4-methyl-5-octyl-1,3-dioxan-2-yl]-2-[(2R)-octan-2-yl]phenyl]benzoic acid (PubChem CID 67853036) has the molecular formula C34H50O4 and a molecular weight of 522.77 g/mol. Its IUPAC name is 4-[4-[(2S,4R,5S)-4-methyl-5-octyl-1,3-dioxan-2-yl]-2-[(2R)-octan-2-yl]phenyl]benzoic acid.
| Compound Name | 4-[4-[(2S,4R,5S)-4-methyl-5-octyl-1,3-dioxan-2-yl]-2-[(2R)-octan-2-yl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 67853036 |
| Molecular Formula | C34H50O4 |
| Molecular Weight | 522.77 g/mol |
| Exact Mass | 522.37 |
| IUPAC Name | 4-[4-[(2S,4R,5S)-4-methyl-5-octyl-1,3-dioxan-2-yl]-2-[(2R)-octan-2-yl]phenyl]benzoic acid |
| SMILES | CCCCCCCC[C@H]1CO[C@H](c2ccc(-c3ccc(C(=O)O)cc3)c([C@H](C)CCCCCC)c2)O[C@@H]1C |
| InChI | InChI=1S/C34H50O4/c1-5-7-9-11-12-14-16-30-24-37-34(38-26(30)4)29-21-22-31(27-17-19-28(20-18-27)33(35)36)32(23-29)25(3)15-13-10-8-6-2/h17-23,25-26,30,34H,5-16,24H2,1-4H3,(H,35,36)/t25-,26-,30+,34+/m1/s1 |
| InChIKey | NXHKHKCHLLGNJH-LJPLZYNQSA-N |
| XLogP | 9.93 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.77 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|