C25H29FN2O3 — CID 67853041
[3-[4-(4-fluorophenyl)-4-oxobutyl]-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl] N,N-dimethylcarbamate (PubChem CID 67853041) has the molecular formula C25H29FN2O3 and a molecular weight of 424.52 g/mol. Its IUPAC name is [3-[4-(4-fluorophenyl)-4-oxobutyl]-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl] N,N-dimethylcarbamate.
| Compound Name | [3-[4-(4-fluorophenyl)-4-oxobutyl]-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 67853041 |
| Molecular Formula | C25H29FN2O3 |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | [3-[4-(4-fluorophenyl)-4-oxobutyl]-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)Oc1cccc2c1CCC1C2CCN1CCCC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H29FN2O3/c1-27(2)25(30)31-24-7-3-5-19-20-14-16-28(22(20)13-12-21(19)24)15-4-6-23(29)17-8-10-18(26)11-9-17/h3,5,7-11,20,22H,4,6,12-16H2,1-2H3 |
| InChIKey | PKOYHKBLMDEFEK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |