C20H36O — CID 67853298
1-(1-prop-2-enoxyethyl)-4-(4-propylcyclohexyl)cyclohexane (PubChem CID 67853298) has the molecular formula C20H36O and a molecular weight of 292.51 g/mol. Its IUPAC name is 1-(1-prop-2-enoxyethyl)-4-(4-propylcyclohexyl)cyclohexane.
| Compound Name | 1-(1-prop-2-enoxyethyl)-4-(4-propylcyclohexyl)cyclohexane |
|---|---|
| PubChem CID | 67853298 |
| Molecular Formula | C20H36O |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.28 |
| IUPAC Name | 1-(1-prop-2-enoxyethyl)-4-(4-propylcyclohexyl)cyclohexane |
| SMILES | C=CCOC(C)C1CCC(C2CCC(CCC)CC2)CC1 |
| InChI | InChI=1S/C20H36O/c1-4-6-17-7-9-19(10-8-17)20-13-11-18(12-14-20)16(3)21-15-5-2/h5,16-20H,2,4,6-15H2,1,3H3 |
| InChIKey | IZZIKHXBHHQFFD-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|