C14H27NO11 — CID 67853351
(2R,3R,4S,5S,6R)-6-[[(2R,3R,4S,5S,6R)-3-(2-aminoethoxy)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxane-2,3,4,5-tetrol (PubChem CID 67853351) has the molecular formula C14H27NO11 and a molecular weight of 385.37 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-6-[[(2R,3R,4S,5S,6R)-3-(2-aminoethoxy)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxane-2,3,4,5-tetrol.
| Compound Name | (2R,3R,4S,5S,6R)-6-[[(2R,3R,4S,5S,6R)-3-(2-aminoethoxy)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 67853351 |
| Molecular Formula | C14H27NO11 |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | (2R,3R,4S,5S,6R)-6-[[(2R,3R,4S,5S,6R)-3-(2-aminoethoxy)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxane-2,3,4,5-tetrol |
| SMILES | NCCO[C@H]1[C@H](OC[C@H]2O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H27NO11/c15-1-2-23-12-10(20)7(17)5(3-16)26-14(12)24-4-6-8(18)9(19)11(21)13(22)25-6/h5-14,16-22H,1-4,15H2/t5-,6-,7-,8-,9+,10+,11-,12-,13-,14-/m1/s1 |
| InChIKey | HYVZXVGXTXGKSR-LOUZWEESSA-N |
| XLogP | -5.41 |
| TPSA | 204.55 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | -5.41 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |