C21H40N2O3 — CID 67853390
tert-butyl (4R)-4-(cyclohexylmethyl)-2,2-dimethyl-5-(propylaminomethyl)-1,3-oxazolidine-3-carboxylate (PubChem CID 67853390) has the molecular formula C21H40N2O3 and a molecular weight of 368.56 g/mol. Its IUPAC name is tert-butyl (4R)-4-(cyclohexylmethyl)-2,2-dimethyl-5-(propylaminomethyl)-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-4-(cyclohexylmethyl)-2,2-dimethyl-5-(propylaminomethyl)-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 67853390 |
| Molecular Formula | C21H40N2O3 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.30 |
| IUPAC Name | tert-butyl (4R)-4-(cyclohexylmethyl)-2,2-dimethyl-5-(propylaminomethyl)-1,3-oxazolidine-3-carboxylate |
| SMILES | CCCNCC1OC(C)(C)N(C(=O)OC(C)(C)C)[C@@H]1CC1CCCCC1 |
| InChI | InChI=1S/C21H40N2O3/c1-7-13-22-15-18-17(14-16-11-9-8-10-12-16)23(21(5,6)25-18)19(24)26-20(2,3)4/h16-18,22H,7-15H2,1-6H3/t17-,18?/m1/s1 |
| InChIKey | MRAPYMNDVJJJOT-QNSVNVJESA-N |
| XLogP | 4.70 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|