About prop-2-enyl 3-[2-(3,4-dichlorophenyl)phenyl]propanoate
prop-2-enyl 3-[2-(3,4-dichlorophenyl)phenyl]propanoate (PubChem CID 67853686) has the molecular formula C18H16Cl2O2
and a molecular weight of 335.23 g/mol. Its IUPAC name is prop-2-enyl 3-[2-(3,4-dichlorophenyl)phenyl]propanoate.
Molecular Properties
| Compound Name | prop-2-enyl 3-[2-(3,4-dichlorophenyl)phenyl]propanoate |
| PubChem CID | 67853686 |
| Molecular Formula | C18H16Cl2O2 |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | prop-2-enyl 3-[2-(3,4-dichlorophenyl)phenyl]propanoate |
| SMILES | C=CCOC(=O)CCc1ccccc1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H16Cl2O2/c1-2-11-22-18(21)10-8-13-5-3-4-6-15(13)14-7-9-16(19)17(20)12-14/h2-7,9,12H,1,8,10-11H2 |
| InChIKey | OSIIAFQWHCPIOV-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl 3-[2-(3,4-dichlorophenyl)phenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl 3-[2-(3,4-dichlorophenyl)phenyl]propanoate?
The IUPAC name of prop-2-enyl 3-[2-(3,4-dichlorophenyl)phenyl]propanoate (CID 67853686) is prop-2-enyl 3-[2-(3,4-dichlorophenyl)phenyl]propanoate.
What is the SMILES notation for prop-2-enyl 3-[2-(3,4-dichlorophenyl)phenyl]propanoate?
The canonical SMILES for prop-2-enyl 3-[2-(3,4-dichlorophenyl)phenyl]propanoate is C=CCOC(=O)CCc1ccccc1-c1ccc(Cl)c(Cl)c1.
What is the InChIKey of prop-2-enyl 3-[2-(3,4-dichlorophenyl)phenyl]propanoate?
The InChIKey is OSIIAFQWHCPIOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16Cl2O2/c1-2-11-22-18(21)10-8-13-5-3-4-6-15(13)14-7-9-16(19)17(20)12-14/h2-7,9,12H,1,8,10-11H2.
What are the key properties of prop-2-enyl 3-[2-(3,4-dichlorophenyl)phenyl]propanoate?
prop-2-enyl 3-[2-(3,4-dichlorophenyl)phenyl]propanoate has a molecular weight of 335.23 g/mol, XLogP of 5.32, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl 3-[2-(3,4-dichlorophenyl)phenyl]propanoate is sourced from PubChem (CID 67853686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).