About 1-(2,4-diaminophenoxy)ethanol;phenol;dihydrochloride
1-(2,4-diaminophenoxy)ethanol;phenol;dihydrochloride (PubChem CID 67853727) has the molecular formula C14H20Cl2N2O3
and a molecular weight of 335.23 g/mol. Its IUPAC name is 1-(2,4-diaminophenoxy)ethanol;phenol;dihydrochloride.
Molecular Properties
| Compound Name | 1-(2,4-diaminophenoxy)ethanol;phenol;dihydrochloride |
| PubChem CID | 67853727 |
| Molecular Formula | C14H20Cl2N2O3 |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 1-(2,4-diaminophenoxy)ethanol;phenol;dihydrochloride |
| SMILES | CC(O)Oc1ccc(N)cc1N.Cl.Cl.Oc1ccccc1 |
| InChI | InChI=1S/C8H12N2O2.C6H6O.2ClH/c1-5(11)12-8-3-2-6(9)4-7(8)10;7-6-4-2-1-3-5-6;;/h2-5,11H,9-10H2,1H3;1-5,7H;2*1H |
| InChIKey | IRHLJEIFSKXAPJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,4-diaminophenoxy)ethanol;phenol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-diaminophenoxy)ethanol;phenol;dihydrochloride?
The IUPAC name of 1-(2,4-diaminophenoxy)ethanol;phenol;dihydrochloride (CID 67853727) is 1-(2,4-diaminophenoxy)ethanol;phenol;dihydrochloride.
What is the SMILES notation for 1-(2,4-diaminophenoxy)ethanol;phenol;dihydrochloride?
The canonical SMILES for 1-(2,4-diaminophenoxy)ethanol;phenol;dihydrochloride is CC(O)Oc1ccc(N)cc1N.Cl.Cl.Oc1ccccc1.
What is the InChIKey of 1-(2,4-diaminophenoxy)ethanol;phenol;dihydrochloride?
The InChIKey is IRHLJEIFSKXAPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2.C6H6O.2ClH/c1-5(11)12-8-3-2-6(9)4-7(8)10;7-6-4-2-1-3-5-6;;/h2-5,11H,9-10H2,1H3;1-5,7H;2*1H.
What are the key properties of 1-(2,4-diaminophenoxy)ethanol;phenol;dihydrochloride?
1-(2,4-diaminophenoxy)ethanol;phenol;dihydrochloride has a molecular weight of 335.23 g/mol, XLogP of 2.80, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-diaminophenoxy)ethanol;phenol;dihydrochloride is sourced from PubChem (CID 67853727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).