C25H28O11 — CID 67853731
[(2R,3S,4R,5R,6S)-3,4,5-triacetyloxy-6-hydroxy-3-methoxy-6-naphthalen-1-yloxan-2-yl]methyl acetate (PubChem CID 67853731) has the molecular formula C25H28O11 and a molecular weight of 504.49 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-3,4,5-triacetyloxy-6-hydroxy-3-methoxy-6-naphthalen-1-yloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-3,4,5-triacetyloxy-6-hydroxy-3-methoxy-6-naphthalen-1-yloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 67853731 |
| Molecular Formula | C25H28O11 |
| Molecular Weight | 504.49 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-3,4,5-triacetyloxy-6-hydroxy-3-methoxy-6-naphthalen-1-yloxan-2-yl]methyl acetate |
| SMILES | CO[C@@]1(OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@](O)(c2cccc3ccccc23)O[C@@H]1COC(C)=O |
| InChI | InChI=1S/C25H28O11/c1-14(26)32-13-21-25(31-5,35-17(4)29)23(34-16(3)28)22(33-15(2)27)24(30,36-21)20-12-8-10-18-9-6-7-11-19(18)20/h6-12,21-23,30H,13H2,1-5H3/t21-,22-,23-,24+,25+/m1/s1 |
| InChIKey | AGOUOSFIQKZPHC-LFCBLZOASA-N |
| XLogP | 1.72 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.49 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|