C14H13N3 — CID 67854465
8,13,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2(7),8,10,13,15-hexaene (PubChem CID 67854465) has the molecular formula C14H13N3 and a molecular weight of 223.28 g/mol. Its IUPAC name is 8,13,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2(7),8,10,13,15-hexaene.
| Compound Name | 8,13,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2(7),8,10,13,15-hexaene |
|---|---|
| PubChem CID | 67854465 |
| Molecular Formula | C14H13N3 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 8,13,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2(7),8,10,13,15-hexaene |
| SMILES | C1=NCC2=c3cnc4c(c3=NC2=C1)CCCC4 |
| InChI | InChI=1S/C14H13N3/c1-2-4-12-9(3-1)14-11(8-16-12)10-7-15-6-5-13(10)17-14/h5-6,8H,1-4,7H2 |
| InChIKey | XWCIBDUTBSJQGH-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |