C13H25N5S — CID 67854525
ethene;6-ethylsulfanyl-2-N,4-N-di(propan-2-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 67854525) has the molecular formula C13H25N5S and a molecular weight of 283.45 g/mol. Its IUPAC name is ethene;6-ethylsulfanyl-2-N,4-N-di(propan-2-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | ethene;6-ethylsulfanyl-2-N,4-N-di(propan-2-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 67854525 |
| Molecular Formula | C13H25N5S |
| Molecular Weight | 283.45 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | ethene;6-ethylsulfanyl-2-N,4-N-di(propan-2-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | C=C.CCSc1nc(NC(C)C)nc(NC(C)C)n1 |
| InChI | InChI=1S/C11H21N5S.C2H4/c1-6-17-11-15-9(12-7(2)3)14-10(16-11)13-8(4)5;1-2/h7-8H,6H2,1-5H3,(H2,12,13,14,15,16);1-2H2 |
| InChIKey | SZCCHMXJAZDBPL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|